C22H22F6N2O2 — CID 162357936
(Z)-1,1,1,5,5,5-hexafluoro-4-[2-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]ethylimino]pent-2-en-2-amine (PubChem CID 162357936) has the molecular formula C22H22F6N2O2 and a molecular weight of 460.42 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-[2-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]ethylimino]pent-2-en-2-amine.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-[2-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]ethylimino]pent-2-en-2-amine |
|---|---|
| PubChem CID | 162357936 |
| Molecular Formula | C22H22F6N2O2 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-[2-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]ethylimino]pent-2-en-2-amine |
| SMILES | COc1ccc(CCOc2ccccc2CC/N=C(/C=C(\N)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F6N2O2/c1-31-17-8-6-15(7-9-17)11-13-32-18-5-3-2-4-16(18)10-12-30-20(22(26,27)28)14-19(29)21(23,24)25/h2-9,14H,10-13,29H2,1H3/b19-14-,30-20- |
| InChIKey | FWLFUFAREOULSU-AHSBLRQHSA-N |
| XLogP | 5.27 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|