C9H13N3 — CID 162358341
ethane;4-methyl-7H-pyrrolo[3,4-d]pyrimidine (PubChem CID 162358341) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is ethane;4-methyl-7H-pyrrolo[3,4-d]pyrimidine.
| Compound Name | ethane;4-methyl-7H-pyrrolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 162358341 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | ethane;4-methyl-7H-pyrrolo[3,4-d]pyrimidine |
| SMILES | CC.Cc1ncnc2c1C=NC2 |
| InChI | InChI=1S/C7H7N3.C2H6/c1-5-6-2-8-3-7(6)10-4-9-5;1-2/h2,4H,3H2,1H3;1-2H3 |
| InChIKey | CDZOONOBODURSJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |