About ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine
ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine (PubChem CID 162358342) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine.
Molecular Properties
| Compound Name | ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine |
| PubChem CID | 162358342 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine |
| SMILES | CC.CN=C(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C10H19N3O2.C2H6/c1-11-10(12-2-6-14-7-3-12)13-4-8-15-9-5-13;1-2/h2-9H2,1H3;1-2H3 |
| InChIKey | KHQKNVATCRZCJX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine?
The IUPAC name of ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine (CID 162358342) is ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine.
What is the SMILES notation for ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine?
The canonical SMILES for ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine is CC.CN=C(N1CCOCC1)N1CCOCC1.
What is the InChIKey of ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine?
The InChIKey is KHQKNVATCRZCJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2.C2H6/c1-11-10(12-2-6-14-7-3-12)13-4-8-15-9-5-13;1-2/h2-9H2,1H3;1-2H3.
What are the key properties of ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine?
ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine has a molecular weight of 243.35 g/mol, XLogP of 0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-1,1-dimorpholin-4-ylmethanimine is sourced from PubChem (CID 162358342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).