About (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine
(Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine (PubChem CID 162358359) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine.
Molecular Properties
| Compound Name | (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine |
| PubChem CID | 162358359 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine |
| SMILES | C=CC1=NCCC/C1=C/N |
| InChI | InChI=1S/C8H12N2/c1-2-8-7(6-9)4-3-5-10-8/h2,6H,1,3-5,9H2/b7-6- |
| InChIKey | QDVJZAVQHXFWGW-SREVYHEPSA-N |
| XLogP | 1.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine?
The IUPAC name of (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine (CID 162358359) is (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine.
What is the SMILES notation for (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine?
The canonical SMILES for (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine is C=CC1=NCCC/C1=C/N.
What is the InChIKey of (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine?
The InChIKey is QDVJZAVQHXFWGW-SREVYHEPSA-N. The full InChI is InChI=1S/C8H12N2/c1-2-8-7(6-9)4-3-5-10-8/h2,6H,1,3-5,9H2/b7-6-.
What are the key properties of (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine?
(Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine has a molecular weight of 136.20 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-(6-ethenyl-3,4-dihydro-2H-pyridin-5-ylidene)methanamine is sourced from PubChem (CID 162358359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).