C19H33N3 — CID 162358395
bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanimine (PubChem CID 162358395) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanimine.
| Compound Name | bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanimine |
|---|---|
| PubChem CID | 162358395 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanimine |
| SMILES | [H]N=C(N1CCCC2CCCCC21)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C19H33N3/c20-19(21-13-5-9-15-7-1-3-11-17(15)21)22-14-6-10-16-8-2-4-12-18(16)22/h15-18,20H,1-14H2 |
| InChIKey | ZJYUGWBMBDPFOC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|