C22H19NO3 — CID 162358406
7-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-4-phenyl-3,4-dihydro-1H-pyrano[4,3-b]pyridine-2,5-dione (PubChem CID 162358406) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 7-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-4-phenyl-3,4-dihydro-1H-pyrano[4,3-b]pyridine-2,5-dione.
| Compound Name | 7-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-4-phenyl-3,4-dihydro-1H-pyrano[4,3-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 162358406 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 7-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-4-phenyl-3,4-dihydro-1H-pyrano[4,3-b]pyridine-2,5-dione |
| SMILES | C=C/C=C(C=C)/C=C/c1cc2c(c(=O)o1)C(c1ccccc1)CC(=O)N2 |
| InChI | InChI=1S/C22H19NO3/c1-3-8-15(4-2)11-12-17-13-19-21(22(25)26-17)18(14-20(24)23-19)16-9-6-5-7-10-16/h3-13,18H,1-2,14H2,(H,23,24)/b12-11+,15-8+ |
| InChIKey | LIWNJBRIKNPPDC-MCQLXRESSA-N |
| XLogP | 4.43 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|