About 2-acetyloxypent-4-enyl acetate
2-acetyloxypent-4-enyl acetate (PubChem CID 162358766) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-acetyloxypent-4-enyl acetate.
Molecular Properties
| Compound Name | 2-acetyloxypent-4-enyl acetate |
| PubChem CID | 162358766 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-acetyloxypent-4-enyl acetate |
| SMILES | C=CCC(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C9H14O4/c1-4-5-9(13-8(3)11)6-12-7(2)10/h4,9H,1,5-6H2,2-3H3 |
| InChIKey | CJMHWNPPLKVLRE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxypent-4-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxypent-4-enyl acetate?
The IUPAC name of 2-acetyloxypent-4-enyl acetate (CID 162358766) is 2-acetyloxypent-4-enyl acetate.
What is the SMILES notation for 2-acetyloxypent-4-enyl acetate?
The canonical SMILES for 2-acetyloxypent-4-enyl acetate is C=CCC(COC(C)=O)OC(C)=O.
What is the InChIKey of 2-acetyloxypent-4-enyl acetate?
The InChIKey is CJMHWNPPLKVLRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-4-5-9(13-8(3)11)6-12-7(2)10/h4,9H,1,5-6H2,2-3H3.
What are the key properties of 2-acetyloxypent-4-enyl acetate?
2-acetyloxypent-4-enyl acetate has a molecular weight of 186.21 g/mol, XLogP of 1.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxypent-4-enyl acetate is sourced from PubChem (CID 162358766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).