C14H17IN4O3S — CID 162359049
3-iodo-N-(3-methyl-1,1-dioxothietan-3-yl)-1-propan-2-ylpyrazolo[4,3-b]pyridine-6-carboxamide (PubChem CID 162359049) has the molecular formula C14H17IN4O3S and a molecular weight of 448.29 g/mol. Its IUPAC name is 3-iodo-N-(3-methyl-1,1-dioxothietan-3-yl)-1-propan-2-ylpyrazolo[4,3-b]pyridine-6-carboxamide.
| Compound Name | 3-iodo-N-(3-methyl-1,1-dioxothietan-3-yl)-1-propan-2-ylpyrazolo[4,3-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 162359049 |
| Molecular Formula | C14H17IN4O3S |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 3-iodo-N-(3-methyl-1,1-dioxothietan-3-yl)-1-propan-2-ylpyrazolo[4,3-b]pyridine-6-carboxamide |
| SMILES | CC(C)n1nc(I)c2ncc(C(=O)NC3(C)CS(=O)(=O)C3)cc21 |
| InChI | InChI=1S/C14H17IN4O3S/c1-8(2)19-10-4-9(5-16-11(10)12(15)18-19)13(20)17-14(3)6-23(21,22)7-14/h4-5,8H,6-7H2,1-3H3,(H,17,20) |
| InChIKey | AIIGLAKKRLDYQI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|