C14H6Br2ClNO3 — CID 162359829
6,8-dibromo-2-(6-chloro-5-hydroxy-2-pyridinyl)chromen-4-one (PubChem CID 162359829) has the molecular formula C14H6Br2ClNO3 and a molecular weight of 431.47 g/mol. Its IUPAC name is 6,8-dibromo-2-(6-chloro-5-hydroxy-2-pyridinyl)chromen-4-one.
| Compound Name | 6,8-dibromo-2-(6-chloro-5-hydroxy-2-pyridinyl)chromen-4-one |
|---|---|
| PubChem CID | 162359829 |
| Molecular Formula | C14H6Br2ClNO3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 428.84 |
| IUPAC Name | 6,8-dibromo-2-(6-chloro-5-hydroxy-2-pyridinyl)chromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)c(Cl)n2)oc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C14H6Br2ClNO3/c15-6-3-7-11(20)5-12(21-13(7)8(16)4-6)9-1-2-10(19)14(17)18-9/h1-5,19H |
| InChIKey | JGYOVCQQVJSYOW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|