About 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile
4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile (PubChem CID 162359887) has the molecular formula C20H21NO3S2
and a molecular weight of 387.53 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile |
| PubChem CID | 162359887 |
| Molecular Formula | C20H21NO3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile |
| SMILES | COc1ccc(C2(C(O)c3ccc(C#N)cc3)SCCCS2)cc1OC |
| InChI | InChI=1S/C20H21NO3S2/c1-23-17-9-8-16(12-18(17)24-2)20(25-10-3-11-26-20)19(22)15-6-4-14(13-21)5-7-15/h4-9,12,19,22H,3,10-11H2,1-2H3 |
| InChIKey | NIPVEOCMTINXFS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile?
The IUPAC name of 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile (CID 162359887) is 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile.
What is the SMILES notation for 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile?
The canonical SMILES for 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile is COc1ccc(C2(C(O)c3ccc(C#N)cc3)SCCCS2)cc1OC.
What is the InChIKey of 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile?
The InChIKey is NIPVEOCMTINXFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO3S2/c1-23-17-9-8-16(12-18(17)24-2)20(25-10-3-11-26-20)19(22)15-6-4-14(13-21)5-7-15/h4-9,12,19,22H,3,10-11H2,1-2H3.
What are the key properties of 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile?
4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile has a molecular weight of 387.53 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-hydroxymethyl]benzonitrile is sourced from PubChem (CID 162359887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).