C26H33N7O3S — CID 162359990
12-methyl-4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one (PubChem CID 162359990) has the molecular formula C26H33N7O3S and a molecular weight of 523.66 g/mol. Its IUPAC name is 12-methyl-4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one.
| Compound Name | 12-methyl-4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one |
|---|---|
| PubChem CID | 162359990 |
| Molecular Formula | C26H33N7O3S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 12-methyl-4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one |
| SMILES | CC1C(=O)Nc2cc3cnc(Nc4ccc(S(=O)(=O)N5CCN(C)CC5)cc4)nc3n2C12CCCCC2 |
| InChI | InChI=1S/C26H33N7O3S/c1-18-24(34)29-22-16-19-17-27-25(30-23(19)33(22)26(18)10-4-3-5-11-26)28-20-6-8-21(9-7-20)37(35,36)32-14-12-31(2)13-15-32/h6-9,16-18H,3-5,10-15H2,1-2H3,(H,29,34)(H,27,28,30) |
| InChIKey | CELCCCWTAADGDV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |