About 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane
2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane (PubChem CID 162360052) has the molecular formula C15H19ClIN3OS
and a molecular weight of 451.76 g/mol. Its IUPAC name is 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane.
Molecular Properties
| Compound Name | 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane |
| PubChem CID | 162360052 |
| Molecular Formula | C15H19ClIN3OS |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane |
| SMILES | CC.O=CC1(Nc2nc(Cl)ncc2C#CSI)CCCCC1 |
| InChI | InChI=1S/C13H13ClIN3OS.C2H6/c14-12-16-8-10(4-7-20-15)11(17-12)18-13(9-19)5-2-1-3-6-13;1-2/h8-9H,1-3,5-6H2,(H,16,17,18);1-2H3 |
| InChIKey | YMWJVYROWUTVLN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane?
The IUPAC name of 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane (CID 162360052) is 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane.
What is the SMILES notation for 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane?
The canonical SMILES for 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane is CC.O=CC1(Nc2nc(Cl)ncc2C#CSI)CCCCC1.
What is the InChIKey of 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane?
The InChIKey is YMWJVYROWUTVLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClIN3OS.C2H6/c14-12-16-8-10(4-7-20-15)11(17-12)18-13(9-19)5-2-1-3-6-13;1-2/h8-9H,1-3,5-6H2,(H,16,17,18);1-2H3.
What are the key properties of 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane?
2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane has a molecular weight of 451.76 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-4-[(1-formylcyclohexyl)amino]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane is sourced from PubChem (CID 162360052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).