C20H23N7O3S — CID 162360058
4-[(10-methyl-12-oxospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfonamide (PubChem CID 162360058) has the molecular formula C20H23N7O3S and a molecular weight of 441.52 g/mol. Its IUPAC name is 4-[(10-methyl-12-oxospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(10-methyl-12-oxospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 162360058 |
| Molecular Formula | C20H23N7O3S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-[(10-methyl-12-oxospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]benzenesulfonamide |
| SMILES | CN1NC(=O)C2(CCCCC2)n2c1cc1cnc(Nc3ccc(S(N)(=O)=O)cc3)nc12 |
| InChI | InChI=1S/C20H23N7O3S/c1-26-16-11-13-12-22-19(23-14-5-7-15(8-6-14)31(21,29)30)24-17(13)27(16)20(18(28)25-26)9-3-2-4-10-20/h5-8,11-12H,2-4,9-10H2,1H3,(H,25,28)(H2,21,29,30)(H,22,23,24) |
| InChIKey | YQOZFMRCEONJEU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |