C26H31N7O3 — CID 162360096
10-hydroxy-4-[4-(4-methylpiperazine-1-carbonyl)anilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-12-one (PubChem CID 162360096) has the molecular formula C26H31N7O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is 10-hydroxy-4-[4-(4-methylpiperazine-1-carbonyl)anilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-12-one.
| Compound Name | 10-hydroxy-4-[4-(4-methylpiperazine-1-carbonyl)anilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-12-one |
|---|---|
| PubChem CID | 162360096 |
| Molecular Formula | C26H31N7O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 10-hydroxy-4-[4-(4-methylpiperazine-1-carbonyl)anilino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-12-one |
| SMILES | CN1CCN(C(=O)c2ccc(Nc3ncc4cc5n(c4n3)C3(CCCCC3)C(=O)NC5O)cc2)CC1 |
| InChI | InChI=1S/C26H31N7O3/c1-31-11-13-32(14-12-31)23(35)17-5-7-19(8-6-17)28-25-27-16-18-15-20-22(34)30-24(36)26(9-3-2-4-10-26)33(20)21(18)29-25/h5-8,15-16,22,34H,2-4,9-14H2,1H3,(H,30,36)(H,27,28,29) |
| InChIKey | VASFNXBXECJRSY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |