C25H31N7O3S — CID 162360110
4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one (PubChem CID 162360110) has the molecular formula C25H31N7O3S and a molecular weight of 509.64 g/mol. Its IUPAC name is 4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one.
| Compound Name | 4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one |
|---|---|
| PubChem CID | 162360110 |
| Molecular Formula | C25H31N7O3S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 4-[4-(4-methylpiperazin-1-yl)sulfonylanilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Nc3ncc4cc5n(c4n3)C3(CCCCC3)CC(=O)N5)cc2)CC1 |
| InChI | InChI=1S/C25H31N7O3S/c1-30-11-13-31(14-12-30)36(34,35)20-7-5-19(6-8-20)27-24-26-17-18-15-21-28-22(33)16-25(9-3-2-4-10-25)32(21)23(18)29-24/h5-8,15,17H,2-4,9-14,16H2,1H3,(H,28,33)(H,26,27,29) |
| InChIKey | TYSWNLQZLBRNSE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |