C19H21N7O2S — CID 162360213
4-(spiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-ylamino)benzenesulfonamide (PubChem CID 162360213) has the molecular formula C19H21N7O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is 4-(spiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-ylamino)benzenesulfonamide.
| Compound Name | 4-(spiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 162360213 |
| Molecular Formula | C19H21N7O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-(spiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8,11-pentaene-13,1'-cyclohexane]-4-ylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2ncc3cc4n(c3n2)C2(C=NN4)CCCCC2)cc1 |
| InChI | InChI=1S/C19H21N7O2S/c20-29(27,28)15-6-4-14(5-7-15)23-18-21-11-13-10-16-25-22-12-19(8-2-1-3-9-19)26(16)17(13)24-18/h4-7,10-12,25H,1-3,8-9H2,(H2,20,27,28)(H,21,23,24) |
| InChIKey | YLWSVZLNZZVTSM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |