C20H22N6O3S — CID 162360287
4-amino-N-(10-oxospiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)benzenesulfonamide (PubChem CID 162360287) has the molecular formula C20H22N6O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is 4-amino-N-(10-oxospiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(10-oxospiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 162360287 |
| Molecular Formula | C20H22N6O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 4-amino-N-(10-oxospiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ncc3cc4n(c3n2)C2(CCCCC2)CNC4=O)cc1 |
| InChI | InChI=1S/C20H22N6O3S/c21-14-4-6-15(7-5-14)30(28,29)25-19-22-11-13-10-16-18(27)23-12-20(8-2-1-3-9-20)26(16)17(13)24-19/h4-7,10-11H,1-3,8-9,12,21H2,(H,23,27)(H,22,24,25) |
| InChIKey | YJGKHEQGTLAYHU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|