C26H31N7O2 — CID 162360319
4-[4-(4-methylpiperazine-1-carbonyl)anilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one (PubChem CID 162360319) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 4-[4-(4-methylpiperazine-1-carbonyl)anilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one.
| Compound Name | 4-[4-(4-methylpiperazine-1-carbonyl)anilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one |
|---|---|
| PubChem CID | 162360319 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 4-[4-(4-methylpiperazine-1-carbonyl)anilino]spiro[1,3,5,10-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-11-one |
| SMILES | CN1CCN(C(=O)c2ccc(Nc3ncc4cc5n(c4n3)C3(CCCCC3)CC(=O)N5)cc2)CC1 |
| InChI | InChI=1S/C26H31N7O2/c1-31-11-13-32(14-12-31)24(35)18-5-7-20(8-6-18)28-25-27-17-19-15-21-29-22(34)16-26(9-3-2-4-10-26)33(21)23(19)30-25/h5-8,15,17H,2-4,9-14,16H2,1H3,(H,29,34)(H,27,28,30) |
| InChIKey | YZVFJIYEYQIHIP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |