C15H16ClN5O3S — CID 162361028
5-[4-(7-chloro-2,5,8-trideuterio-[1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-oxazole (PubChem CID 162361028) has the molecular formula C15H16ClN5O3S and a molecular weight of 384.86 g/mol. Its IUPAC name is 5-[4-(7-chloro-2,5,8-trideuterio-[1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-oxazole.
| Compound Name | 5-[4-(7-chloro-2,5,8-trideuterio-[1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 162361028 |
| Molecular Formula | C15H16ClN5O3S |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 5-[4-(7-chloro-2,5,8-trideuterio-[1,2,4]triazolo[1,5-a]pyridin-6-yl)piperidin-1-yl]sulfonyl-2-methyl-1,3-oxazole |
| SMILES | [2H]c1nc2c([2H])c(Cl)c(C3CCN(S(=O)(=O)c4cnc(C)o4)CC3)c([2H])n2n1 |
| InChI | InChI=1S/C15H16ClN5O3S/c1-10-17-7-15(24-10)25(22,23)20-4-2-11(3-5-20)12-8-21-14(6-13(12)16)18-9-19-21/h6-9,11H,2-5H2,1H3/i6D,8D,9D |
| InChIKey | URAUBDCJGRESTK-VCNSICBKSA-N |
| XLogP | 2.25 |
| TPSA | 93.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |