C21H20FN5O2 — CID 162362138
N-(3-fluorophenyl)-4-(12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 162362138) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-(12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-(3-fluorophenyl)-4-(12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 162362138 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-(3-fluorophenyl)-4-(12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)N1CC=C(c2ncnc3[nH]c4c(c23)COCC4)CC1 |
| InChI | InChI=1S/C21H20FN5O2/c22-14-2-1-3-15(10-14)25-21(28)27-7-4-13(5-8-27)19-18-16-11-29-9-6-17(16)26-20(18)24-12-23-19/h1-4,10,12H,5-9,11H2,(H,25,28)(H,23,24,26) |
| InChIKey | XYUTXRORYQNEMI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |