About 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol
2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol (PubChem CID 162362152) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol |
| PubChem CID | 162362152 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol |
| SMILES | C=CC1=C(C=C)C(NC)CCC1.CO |
| InChI | InChI=1S/C11H17N.CH4O/c1-4-9-7-6-8-11(12-3)10(9)5-2;1-2/h4-5,11-12H,1-2,6-8H2,3H3;2H,1H3 |
| InChIKey | HUSIMCZKTFITBS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol?
The IUPAC name of 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol (CID 162362152) is 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol.
What is the SMILES notation for 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol?
The canonical SMILES for 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol is C=CC1=C(C=C)C(NC)CCC1.CO.
What is the InChIKey of 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol?
The InChIKey is HUSIMCZKTFITBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.CH4O/c1-4-9-7-6-8-11(12-3)10(9)5-2;1-2/h4-5,11-12H,1-2,6-8H2,3H3;2H,1H3.
What are the key properties of 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol?
2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol has a molecular weight of 195.31 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-N-methylcyclohex-2-en-1-amine;methanol is sourced from PubChem (CID 162362152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).