C21H22BrN5O — CID 162362160
(3-bromoanilino)-[4-(7,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-3,6-dihydro-2H-pyridin-1-yl]methanol (PubChem CID 162362160) has the molecular formula C21H22BrN5O and a molecular weight of 440.35 g/mol. Its IUPAC name is (3-bromoanilino)-[4-(7,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-3,6-dihydro-2H-pyridin-1-yl]methanol.
| Compound Name | (3-bromoanilino)-[4-(7,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-3,6-dihydro-2H-pyridin-1-yl]methanol |
|---|---|
| PubChem CID | 162362160 |
| Molecular Formula | C21H22BrN5O |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (3-bromoanilino)-[4-(7,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)-3,6-dihydro-2H-pyridin-1-yl]methanol |
| SMILES | OC(Nc1cccc(Br)c1)N1CC=C(c2ncnc3[nH]c4c(c23)CCC4)CC1 |
| InChI | InChI=1S/C21H22BrN5O/c22-14-3-1-4-15(11-14)25-21(28)27-9-7-13(8-10-27)19-18-16-5-2-6-17(16)26-20(18)24-12-23-19/h1,3-4,7,11-12,21,25,28H,2,5-6,8-10H2,(H,23,24,26) |
| InChIKey | WTXVEKHJIQINEC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|