C27H36FN5O3 — CID 162362507
(Z)-4-amino-N-[(1S)-2-[4-(1,2-dimethyl-6-oxo-3-pyridinyl)-3-fluoroanilino]oxy-1-(4-methylcyclohexyl)ethyl]-2-methyliminobut-3-enamide (PubChem CID 162362507) has the molecular formula C27H36FN5O3 and a molecular weight of 497.62 g/mol. Its IUPAC name is (Z)-4-amino-N-[(1S)-2-[4-(1,2-dimethyl-6-oxo-3-pyridinyl)-3-fluoroanilino]oxy-1-(4-methylcyclohexyl)ethyl]-2-methyliminobut-3-enamide.
| Compound Name | (Z)-4-amino-N-[(1S)-2-[4-(1,2-dimethyl-6-oxo-3-pyridinyl)-3-fluoroanilino]oxy-1-(4-methylcyclohexyl)ethyl]-2-methyliminobut-3-enamide |
|---|---|
| PubChem CID | 162362507 |
| Molecular Formula | C27H36FN5O3 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | (Z)-4-amino-N-[(1S)-2-[4-(1,2-dimethyl-6-oxo-3-pyridinyl)-3-fluoroanilino]oxy-1-(4-methylcyclohexyl)ethyl]-2-methyliminobut-3-enamide |
| SMILES | C/N=C(/C=C\N)C(=O)N[C@H](CONc1ccc(-c2ccc(=O)n(C)c2C)c(F)c1)C1CCC(C)CC1 |
| InChI | InChI=1S/C27H36FN5O3/c1-17-5-7-19(8-6-17)25(31-27(35)24(30-3)13-14-29)16-36-32-20-9-10-22(23(28)15-20)21-11-12-26(34)33(4)18(21)2/h9-15,17,19,25,32H,5-8,16,29H2,1-4H3,(H,31,35)/b14-13-,30-24-/t17?,19?,25-/m1/s1 |
| InChIKey | XDWIUNGHTOQDFF-INCKPIRVSA-N |
| XLogP | 3.70 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|