C17H15F3N4O2 — CID 162363607
N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxamide (PubChem CID 162363607) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 162363607 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxamide |
| SMILES | C[C@@H]1C[C@@H](NC(=O)c2ncc(-c3cccc(C(F)(F)F)c3)o2)CN1C#N |
| InChI | InChI=1S/C17H15F3N4O2/c1-10-5-13(8-24(10)9-21)23-15(25)16-22-7-14(26-16)11-3-2-4-12(6-11)17(18,19)20/h2-4,6-7,10,13H,5,8H2,1H3,(H,23,25)/t10-,13-/m1/s1 |
| InChIKey | LGCMXEKXOHJBFS-ZWNOBZJWSA-N |
| XLogP | 3.03 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|