C17H17ClF3N5O3 — CID 162363616
5-[2-chloro-5-(trifluoromethyl)phenyl]-N-(1-cyanopyrrolidin-3-yl)-1,3,4-oxadiazole-2-carboxamide;methoxymethane (PubChem CID 162363616) has the molecular formula C17H17ClF3N5O3 and a molecular weight of 431.80 g/mol. Its IUPAC name is 5-[2-chloro-5-(trifluoromethyl)phenyl]-N-(1-cyanopyrrolidin-3-yl)-1,3,4-oxadiazole-2-carboxamide;methoxymethane.
| Compound Name | 5-[2-chloro-5-(trifluoromethyl)phenyl]-N-(1-cyanopyrrolidin-3-yl)-1,3,4-oxadiazole-2-carboxamide;methoxymethane |
|---|---|
| PubChem CID | 162363616 |
| Molecular Formula | C17H17ClF3N5O3 |
| Molecular Weight | 431.80 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 5-[2-chloro-5-(trifluoromethyl)phenyl]-N-(1-cyanopyrrolidin-3-yl)-1,3,4-oxadiazole-2-carboxamide;methoxymethane |
| SMILES | COC.N#CN1CCC(NC(=O)c2nnc(-c3cc(C(F)(F)F)ccc3Cl)o2)C1 |
| InChI | InChI=1S/C15H11ClF3N5O2.C2H6O/c16-11-2-1-8(15(17,18)19)5-10(11)13-22-23-14(26-13)12(25)21-9-3-4-24(6-9)7-20;1-3-2/h1-2,5,9H,3-4,6H2,(H,21,25);1-2H3 |
| InChIKey | MTOGQKQYSSUGEB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|