C10H5F5O2 — CID 162363712
5-(1,1,2,2,2-pentafluoroethyl)-3H-2-benzofuran-1-one (PubChem CID 162363712) has the molecular formula C10H5F5O2 and a molecular weight of 252.14 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-3H-2-benzofuran-1-one.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 162363712 |
| Molecular Formula | C10H5F5O2 |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-3H-2-benzofuran-1-one |
| SMILES | O=C1OCc2cc(C(F)(F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C10H5F5O2/c11-9(12,10(13,14)15)6-1-2-7-5(3-6)4-17-8(7)16/h1-3H,4H2 |
| InChIKey | BUFPVKQZQXIENP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|