C21H28BrMnN4O2- — CID 162364106
2-(6-bromo-1-oxo-4-propan-2-ylphthalazin-2-yl)-N-(1-ethyl-3-methanidylpiperidin-3-yl)acetamide;manganese (PubChem CID 162364106) has the molecular formula C21H28BrMnN4O2- and a molecular weight of 503.32 g/mol. Its IUPAC name is 2-(6-bromo-1-oxo-4-propan-2-ylphthalazin-2-yl)-N-(1-ethyl-3-methanidylpiperidin-3-yl)acetamide;manganese.
| Compound Name | 2-(6-bromo-1-oxo-4-propan-2-ylphthalazin-2-yl)-N-(1-ethyl-3-methanidylpiperidin-3-yl)acetamide;manganese |
|---|---|
| PubChem CID | 162364106 |
| Molecular Formula | C21H28BrMnN4O2- |
| Molecular Weight | 503.32 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 2-(6-bromo-1-oxo-4-propan-2-ylphthalazin-2-yl)-N-(1-ethyl-3-methanidylpiperidin-3-yl)acetamide;manganese |
| SMILES | [CH2-]C1(NC(=O)Cn2nc(C(C)C)c3cc(Br)ccc3c2=O)CCCN(CC)C1.[Mn] |
| InChI | InChI=1S/C21H28BrN4O2.Mn/c1-5-25-10-6-9-21(4,13-25)23-18(27)12-26-20(28)16-8-7-15(22)11-17(16)19(24-26)14(2)3;/h7-8,11,14H,4-6,9-10,12-13H2,1-3H3,(H,23,27);/q-1; |
| InChIKey | XDOVIOZCPYRCNF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|