C22H30F3N3O2 — CID 162364304
2-ethyl-4-propan-2-yl-6-(trifluoromethyl)phthalazin-1-one;N-(4-methylcyclohexyl)formamide (PubChem CID 162364304) has the molecular formula C22H30F3N3O2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-ethyl-4-propan-2-yl-6-(trifluoromethyl)phthalazin-1-one;N-(4-methylcyclohexyl)formamide.
| Compound Name | 2-ethyl-4-propan-2-yl-6-(trifluoromethyl)phthalazin-1-one;N-(4-methylcyclohexyl)formamide |
|---|---|
| PubChem CID | 162364304 |
| Molecular Formula | C22H30F3N3O2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-ethyl-4-propan-2-yl-6-(trifluoromethyl)phthalazin-1-one;N-(4-methylcyclohexyl)formamide |
| SMILES | CC1CCC(NC=O)CC1.CCn1nc(C(C)C)c2cc(C(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C14H15F3N2O.C8H15NO/c1-4-19-13(20)10-6-5-9(14(15,16)17)7-11(10)12(18-19)8(2)3;1-7-2-4-8(5-3-7)9-6-10/h5-8H,4H2,1-3H3;6-8H,2-5H2,1H3,(H,9,10) |
| InChIKey | NGFYLWURTQEVJL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|