C22H21ClF6N6O3 — CID 162364495
N-[3-(2-chloro-4,6-difluoroanilino)-7-fluoro-1-methyl-4-(2,2,2-trifluoroethoxy)indazol-6-yl]-N-[(Z)-[1-[ethyl(methyl)amino]-2-hydroxyethylidene]amino]formamide (PubChem CID 162364495) has the molecular formula C22H21ClF6N6O3 and a molecular weight of 566.89 g/mol. Its IUPAC name is N-[3-(2-chloro-4,6-difluoroanilino)-7-fluoro-1-methyl-4-(2,2,2-trifluoroethoxy)indazol-6-yl]-N-[(Z)-[1-[ethyl(methyl)amino]-2-hydroxyethylidene]amino]formamide.
| Compound Name | N-[3-(2-chloro-4,6-difluoroanilino)-7-fluoro-1-methyl-4-(2,2,2-trifluoroethoxy)indazol-6-yl]-N-[(Z)-[1-[ethyl(methyl)amino]-2-hydroxyethylidene]amino]formamide |
|---|---|
| PubChem CID | 162364495 |
| Molecular Formula | C22H21ClF6N6O3 |
| Molecular Weight | 566.89 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | N-[3-(2-chloro-4,6-difluoroanilino)-7-fluoro-1-methyl-4-(2,2,2-trifluoroethoxy)indazol-6-yl]-N-[(Z)-[1-[ethyl(methyl)amino]-2-hydroxyethylidene]amino]formamide |
| SMILES | CCN(C)/C(CO)=N\N(C=O)c1cc(OCC(F)(F)F)c2c(Nc3c(F)cc(F)cc3Cl)nn(C)c2c1F |
| InChI | InChI=1S/C22H21ClF6N6O3/c1-4-33(2)16(8-36)31-35(10-37)14-7-15(38-9-22(27,28)29)17-20(18(14)26)34(3)32-21(17)30-19-12(23)5-11(24)6-13(19)25/h5-7,10,36H,4,8-9H2,1-3H3,(H,30,32)/b31-16- |
| InChIKey | JOCGIJCWWYEFEP-ACXHZZMFSA-N |
| XLogP | 4.55 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.89 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|