C20H33N3O5S2 — CID 162365409
(3R)-1-[4-(diethylsulfamoyl)phenyl]sulfonyl-N,N-diethylpiperidine-3-carboxamide (PubChem CID 162365409) has the molecular formula C20H33N3O5S2 and a molecular weight of 459.63 g/mol. Its IUPAC name is (3R)-1-[4-(diethylsulfamoyl)phenyl]sulfonyl-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[4-(diethylsulfamoyl)phenyl]sulfonyl-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 162365409 |
| Molecular Formula | C20H33N3O5S2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (3R)-1-[4-(diethylsulfamoyl)phenyl]sulfonyl-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)C1 |
| InChI | InChI=1S/C20H33N3O5S2/c1-5-21(6-2)20(24)17-10-9-15-23(16-17)30(27,28)19-13-11-18(12-14-19)29(25,26)22(7-3)8-4/h11-14,17H,5-10,15-16H2,1-4H3/t17-/m1/s1 |
| InChIKey | XJNLPGFCCUGFTF-QGZVFWFLSA-N |
| XLogP | 1.99 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |