C19H30N2O6S2 — CID 162365444
ethyl (3R)-1-[4-[ethyl(propan-2-yl)sulfamoyl]phenyl]sulfonylpiperidine-3-carboxylate (PubChem CID 162365444) has the molecular formula C19H30N2O6S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is ethyl (3R)-1-[4-[ethyl(propan-2-yl)sulfamoyl]phenyl]sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[4-[ethyl(propan-2-yl)sulfamoyl]phenyl]sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 162365444 |
| Molecular Formula | C19H30N2O6S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | ethyl (3R)-1-[4-[ethyl(propan-2-yl)sulfamoyl]phenyl]sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(S(=O)(=O)N(CC)C(C)C)cc2)C1 |
| InChI | InChI=1S/C19H30N2O6S2/c1-5-21(15(3)4)29(25,26)18-11-9-17(10-12-18)28(23,24)20-13-7-8-16(14-20)19(22)27-6-2/h9-12,15-16H,5-8,13-14H2,1-4H3/t16-/m1/s1 |
| InChIKey | RNBDFZMXFQPKLG-MRXNPFEDSA-N |
| XLogP | 2.07 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |