C20H21N5 — CID 162367594
(3R,4aS,11bS)-4a-(azidomethyl)-3-phenyl-3,4,5,6,7,11b-hexahydropyrido[2,3-d][1]benzazepine (PubChem CID 162367594) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3R,4aS,11bS)-4a-(azidomethyl)-3-phenyl-3,4,5,6,7,11b-hexahydropyrido[2,3-d][1]benzazepine.
| Compound Name | (3R,4aS,11bS)-4a-(azidomethyl)-3-phenyl-3,4,5,6,7,11b-hexahydropyrido[2,3-d][1]benzazepine |
|---|---|
| PubChem CID | 162367594 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (3R,4aS,11bS)-4a-(azidomethyl)-3-phenyl-3,4,5,6,7,11b-hexahydropyrido[2,3-d][1]benzazepine |
| SMILES | [N-]=[N+]=NC[C@]12CCNc3ccccc3[C@@H]1C=C[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C20H21N5/c21-25-23-14-20-12-13-22-19-9-5-4-8-16(19)17(20)10-11-18(24-20)15-6-2-1-3-7-15/h1-11,17-18,22,24H,12-14H2/t17-,18+,20+/m0/s1 |
| InChIKey | ZFMYRGUYOURZBR-NLWGTHIKSA-N |
| XLogP | 4.54 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|