About acenaphthyleno[1,2-d]imidazole-8-thione
acenaphthyleno[1,2-d]imidazole-8-thione (PubChem CID 162368599) has the molecular formula C13H6N2S
and a molecular weight of 222.27 g/mol. Its IUPAC name is acenaphthyleno[1,2-d]imidazole-8-thione.
Molecular Properties
| Compound Name | acenaphthyleno[1,2-d]imidazole-8-thione |
| PubChem CID | 162368599 |
| Molecular Formula | C13H6N2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | acenaphthyleno[1,2-d]imidazole-8-thione |
| SMILES | S=C1N=C2C(=N1)c1cccc3cccc2c13 |
| InChI | InChI=1S/C13H6N2S/c16-13-14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)15-13/h1-6H |
| InChIKey | OJGSKVMXFHSUFU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze acenaphthyleno[1,2-d]imidazole-8-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acenaphthyleno[1,2-d]imidazole-8-thione?
The IUPAC name of acenaphthyleno[1,2-d]imidazole-8-thione (CID 162368599) is acenaphthyleno[1,2-d]imidazole-8-thione.
What is the SMILES notation for acenaphthyleno[1,2-d]imidazole-8-thione?
The canonical SMILES for acenaphthyleno[1,2-d]imidazole-8-thione is S=C1N=C2C(=N1)c1cccc3cccc2c13.
What is the InChIKey of acenaphthyleno[1,2-d]imidazole-8-thione?
The InChIKey is OJGSKVMXFHSUFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6N2S/c16-13-14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)15-13/h1-6H.
What are the key properties of acenaphthyleno[1,2-d]imidazole-8-thione?
acenaphthyleno[1,2-d]imidazole-8-thione has a molecular weight of 222.27 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acenaphthyleno[1,2-d]imidazole-8-thione is sourced from PubChem (CID 162368599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).