About disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate
disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate (PubChem CID 162368683) has the molecular formula C10H7NNa2O7S2
and a molecular weight of 363.28 g/mol. Its IUPAC name is disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate.
Molecular Properties
| Compound Name | disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate |
| PubChem CID | 162368683 |
| Molecular Formula | C10H7NNa2O7S2 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])ccc2c1O.[Na+].[Na+] |
| InChI | InChI=1S/C10H9NO7S2.2Na/c11-9-8(20(16,17)18)4-5-3-6(19(13,14)15)1-2-7(5)10(9)12;;/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18);;/q;2*+1/p-2 |
| InChIKey | ZNQUYMVHSBNQAM-UHFFFAOYSA-L |
| XLogP | -6.06 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | -6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate?
The IUPAC name of disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate (CID 162368683) is disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate.
What is the SMILES notation for disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate?
The canonical SMILES for disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate is Nc1c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])ccc2c1O.[Na+].[Na+].
What is the InChIKey of disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate?
The InChIKey is ZNQUYMVHSBNQAM-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H9NO7S2.2Na/c11-9-8(20(16,17)18)4-5-3-6(19(13,14)15)1-2-7(5)10(9)12;;/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18);;/q;2*+1/p-2.
What are the key properties of disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate?
disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate has a molecular weight of 363.28 g/mol, XLogP of -6.06, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3-amino-4-hydroxynaphthalene-2,7-disulfonate is sourced from PubChem (CID 162368683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).