About 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one
1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one (PubChem CID 162368687) has the molecular formula C20H18N2O
and a molecular weight of 302.38 g/mol. Its IUPAC name is 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one.
Molecular Properties
| Compound Name | 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one |
| PubChem CID | 162368687 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one |
| SMILES | C=C1C(=O)N(Cc2ccccc2)CCC12C=Nc1ccccc12 |
| InChI | InChI=1S/C20H18N2O/c1-15-19(23)22(13-16-7-3-2-4-8-16)12-11-20(15)14-21-18-10-6-5-9-17(18)20/h2-10,14H,1,11-13H2 |
| InChIKey | ZTGVOIRNLBTDKZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one?
The IUPAC name of 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one (CID 162368687) is 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one.
What is the SMILES notation for 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one?
The canonical SMILES for 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one is C=C1C(=O)N(Cc2ccccc2)CCC12C=Nc1ccccc12.
What is the InChIKey of 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one?
The InChIKey is ZTGVOIRNLBTDKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O/c1-15-19(23)22(13-16-7-3-2-4-8-16)12-11-20(15)14-21-18-10-6-5-9-17(18)20/h2-10,14H,1,11-13H2.
What are the key properties of 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one?
1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one has a molecular weight of 302.38 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-benzyl-3'-methylidenespiro[indole-3,4'-piperidine]-2'-one is sourced from PubChem (CID 162368687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).