About 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one
8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one (PubChem CID 162368913) has the molecular formula C13H13NO2S
and a molecular weight of 247.32 g/mol. Its IUPAC name is 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one.
Molecular Properties
| Compound Name | 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one |
| PubChem CID | 162368913 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one |
| SMILES | CCOc1ccc2c(=O)[nH]c3c(c2c1)CCS3 |
| InChI | InChI=1S/C13H13NO2S/c1-2-16-8-3-4-9-11(7-8)10-5-6-17-13(10)14-12(9)15/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | TZCUYFBGOJGUQW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one?
The IUPAC name of 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one (CID 162368913) is 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one.
What is the SMILES notation for 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one?
The canonical SMILES for 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one is CCOc1ccc2c(=O)[nH]c3c(c2c1)CCS3.
What is the InChIKey of 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one?
The InChIKey is TZCUYFBGOJGUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2S/c1-2-16-8-3-4-9-11(7-8)10-5-6-17-13(10)14-12(9)15/h3-4,7H,2,5-6H2,1H3,(H,14,15).
What are the key properties of 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one?
8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one has a molecular weight of 247.32 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethoxy-2,4-dihydro-1H-thieno[2,3-c]isoquinolin-5-one is sourced from PubChem (CID 162368913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).