About (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine
(Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine (PubChem CID 162369076) has the molecular formula C15H20FN3O
and a molecular weight of 277.34 g/mol. Its IUPAC name is (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine |
| PubChem CID | 162369076 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine |
| SMILES | CC1(C)CN=C(c2ccc(OC/C(=C\F)CN)cc2)N1 |
| InChI | InChI=1S/C15H20FN3O/c1-15(2)10-18-14(19-15)12-3-5-13(6-4-12)20-9-11(7-16)8-17/h3-7H,8-10,17H2,1-2H3,(H,18,19)/b11-7- |
| InChIKey | TVHWPVXJWJBNFI-XFFZJAGNSA-N |
| XLogP | 2.01 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine?
The IUPAC name of (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine (CID 162369076) is (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine.
What is the SMILES notation for (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine?
The canonical SMILES for (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine is CC1(C)CN=C(c2ccc(OC/C(=C\F)CN)cc2)N1.
What is the InChIKey of (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine?
The InChIKey is TVHWPVXJWJBNFI-XFFZJAGNSA-N. The full InChI is InChI=1S/C15H20FN3O/c1-15(2)10-18-14(19-15)12-3-5-13(6-4-12)20-9-11(7-16)8-17/h3-7H,8-10,17H2,1-2H3,(H,18,19)/b11-7-.
What are the key properties of (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine?
(Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine has a molecular weight of 277.34 g/mol, XLogP of 2.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine is sourced from PubChem (CID 162369076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).