C15H15N7O3 — CID 162369487
2-ethylimino-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1,3-diazinane-5-carboxamide (PubChem CID 162369487) has the molecular formula C15H15N7O3 and a molecular weight of 341.33 g/mol. Its IUPAC name is 2-ethylimino-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1,3-diazinane-5-carboxamide.
| Compound Name | 2-ethylimino-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 162369487 |
| Molecular Formula | C15H15N7O3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-ethylimino-4,6-dioxo-N-[4-(2H-triazol-4-yl)phenyl]-1,3-diazinane-5-carboxamide |
| SMILES | CCN=C1NC(=O)C(C(=O)Nc2ccc(-c3cn[nH]n3)cc2)C(=O)N1 |
| InChI | InChI=1S/C15H15N7O3/c1-2-16-15-19-13(24)11(14(25)20-15)12(23)18-9-5-3-8(4-6-9)10-7-17-22-21-10/h3-7,11H,2H2,1H3,(H,18,23)(H,17,21,22)(H2,16,19,20,24,25) |
| InChIKey | ZRCOIKUNRYCWAM-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|