C22H45ClN2O — CID 162369758
1-amino-N-hexadecylcyclopentane-1-carboxamide;hydrochloride (PubChem CID 162369758) has the molecular formula C22H45ClN2O and a molecular weight of 389.07 g/mol. Its IUPAC name is 1-amino-N-hexadecylcyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-hexadecylcyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162369758 |
| Molecular Formula | C22H45ClN2O |
| Molecular Weight | 389.07 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | 1-amino-N-hexadecylcyclopentane-1-carboxamide;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCNC(=O)C1(N)CCCC1.Cl |
| InChI | InChI=1S/C22H44N2O.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20-24-21(25)22(23)18-15-16-19-22;/h2-20,23H2,1H3,(H,24,25);1H |
| InChIKey | RIJNHIAWKRDUDE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.07 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|