C22H21F2N3O2 — CID 162370080
6-fluoro-3-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-1,8-naphthyridin-2-one (PubChem CID 162370080) has the molecular formula C22H21F2N3O2 and a molecular weight of 397.43 g/mol. Its IUPAC name is 6-fluoro-3-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-fluoro-3-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 162370080 |
| Molecular Formula | C22H21F2N3O2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 6-fluoro-3-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C(/C=C/c1cncc(F)c1)C1C(=O)NC2NCC(F)CC2C1c1ccccc1 |
| InChI | InChI=1S/C22H21F2N3O2/c23-15-8-13(10-25-11-15)6-7-18(28)20-19(14-4-2-1-3-5-14)17-9-16(24)12-26-21(17)27-22(20)29/h1-8,10-11,16-17,19-21,26H,9,12H2,(H,27,29)/b7-6+ |
| InChIKey | MVZAXSCUQUDQOZ-VOTSOKGWSA-N |
| XLogP | 2.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|