C26H34N6O — CID 162370304
4-(benzotriazol-1-yl)-N-[2-(1-benzylpiperidin-4-yl)ethyl]piperidine-1-carboxamide (PubChem CID 162370304) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 4-(benzotriazol-1-yl)-N-[2-(1-benzylpiperidin-4-yl)ethyl]piperidine-1-carboxamide.
| Compound Name | 4-(benzotriazol-1-yl)-N-[2-(1-benzylpiperidin-4-yl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 162370304 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 4-(benzotriazol-1-yl)-N-[2-(1-benzylpiperidin-4-yl)ethyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCC1CCN(Cc2ccccc2)CC1)N1CCC(n2nnc3ccccc32)CC1 |
| InChI | InChI=1S/C26H34N6O/c33-26(27-15-10-21-11-16-30(17-12-21)20-22-6-2-1-3-7-22)31-18-13-23(14-19-31)32-25-9-5-4-8-24(25)28-29-32/h1-9,21,23H,10-20H2,(H,27,33) |
| InChIKey | BFEQZOQSQVLMRW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |