C28H31N5O2 — CID 162370371
N-[2-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]ethyl]-7-methyl-2-phenylpyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 162370371) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[2-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]ethyl]-7-methyl-2-phenylpyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-[2-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]ethyl]-7-methyl-2-phenylpyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 162370371 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[2-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]ethyl]-7-methyl-2-phenylpyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCC2CCN(Cc3ccccc3O)CC2)cnc2cc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C28H31N5O2/c1-20-24(18-30-27-17-25(31-33(20)27)22-7-3-2-4-8-22)28(35)29-14-11-21-12-15-32(16-13-21)19-23-9-5-6-10-26(23)34/h2-10,17-18,21,34H,11-16,19H2,1H3,(H,29,35) |
| InChIKey | PSDTZVKOPAJVIK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|