C13H12ClF3N4O2 — CID 162370662
1-(4-chloro-3-pyridinyl)-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 162370662) has the molecular formula C13H12ClF3N4O2 and a molecular weight of 348.71 g/mol. Its IUPAC name is 1-(4-chloro-3-pyridinyl)-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-(4-chloro-3-pyridinyl)-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162370662 |
| Molecular Formula | C13H12ClF3N4O2 |
| Molecular Weight | 348.71 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 1-(4-chloro-3-pyridinyl)-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=C1NC(=O)N(c2cnccc2Cl)C2NC(C(F)(F)F)CCC12 |
| InChI | InChI=1S/C13H12ClF3N4O2/c14-7-3-4-18-5-8(7)21-10-6(11(22)20-12(21)23)1-2-9(19-10)13(15,16)17/h3-6,9-10,19H,1-2H2,(H,20,22,23) |
| InChIKey | WTHBLIAHZYRALN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.71 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |