C13H13F3N4O2 — CID 162370663
1-pyridin-3-yl-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 162370663) has the molecular formula C13H13F3N4O2 and a molecular weight of 314.27 g/mol. Its IUPAC name is 1-pyridin-3-yl-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-pyridin-3-yl-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162370663 |
| Molecular Formula | C13H13F3N4O2 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-pyridin-3-yl-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=C1NC(=O)N(c2cccnc2)C2NC(C(F)(F)F)CCC12 |
| InChI | InChI=1S/C13H13F3N4O2/c14-13(15,16)9-4-3-8-10(18-9)20(12(22)19-11(8)21)7-2-1-5-17-6-7/h1-2,5-6,8-10,18H,3-4H2,(H,19,21,22) |
| InChIKey | MIVMJQJTTYBZGI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |