C14H15F3N4O2 — CID 162370671
1-(2-methyl-3-pyridinyl)-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 162370671) has the molecular formula C14H15F3N4O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is 1-(2-methyl-3-pyridinyl)-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-(2-methyl-3-pyridinyl)-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162370671 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(2-methyl-3-pyridinyl)-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1ncccc1N1C(=O)NC(=O)C2CCC(C(F)(F)F)NC21 |
| InChI | InChI=1S/C14H15F3N4O2/c1-7-9(3-2-6-18-7)21-11-8(12(22)20-13(21)23)4-5-10(19-11)14(15,16)17/h2-3,6,8,10-11,19H,4-5H2,1H3,(H,20,22,23) |
| InChIKey | CVVBZDLNMWXSTR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |