C18H19FN4O5S — CID 162370683
5-fluoro-2-methoxy-N-[(11S)-14-oxo-9-oxa-1,7,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl]benzenesulfonamide (PubChem CID 162370683) has the molecular formula C18H19FN4O5S and a molecular weight of 422.44 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-N-[(11S)-14-oxo-9-oxa-1,7,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl]benzenesulfonamide.
| Compound Name | 5-fluoro-2-methoxy-N-[(11S)-14-oxo-9-oxa-1,7,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 162370683 |
| Molecular Formula | C18H19FN4O5S |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 5-fluoro-2-methoxy-N-[(11S)-14-oxo-9-oxa-1,7,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl]benzenesulfonamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)Nc1cnc2c(c1)CN1CC(=O)NC[C@H]1CO2 |
| InChI | InChI=1S/C18H19FN4O5S/c1-27-15-3-2-12(19)5-16(15)29(25,26)22-13-4-11-8-23-9-17(24)20-7-14(23)10-28-18(11)21-6-13/h2-6,14,22H,7-10H2,1H3,(H,20,24)/t14-/m0/s1 |
| InChIKey | SOQQLBJNCXIWQP-AWEZNQCLSA-N |
| XLogP | 0.72 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |