About bis(benzo[h]quinoline-2-carboxylic acid);palladium
bis(benzo[h]quinoline-2-carboxylic acid);palladium (PubChem CID 162370884) has the molecular formula C28H18N2O4Pd
and a molecular weight of 552.88 g/mol. Its IUPAC name is bis(benzo[h]quinoline-2-carboxylic acid);palladium.
Molecular Properties
| Compound Name | bis(benzo[h]quinoline-2-carboxylic acid);palladium |
| PubChem CID | 162370884 |
| Molecular Formula | C28H18N2O4Pd |
| Molecular Weight | 552.88 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | bis(benzo[h]quinoline-2-carboxylic acid);palladium |
| SMILES | O=C(O)c1ccc2ccc3ccccc3c2n1.O=C(O)c1ccc2ccc3ccccc3c2n1.[Pd] |
| InChI | InChI=1S/2C14H9NO2.Pd/c2*16-14(17)12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15-12;/h2*1-8H,(H,16,17); |
| InChIKey | SVZJROMWRDYCRN-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.88 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze bis(benzo[h]quinoline-2-carboxylic acid);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzo[h]quinoline-2-carboxylic acid);palladium?
The IUPAC name of bis(benzo[h]quinoline-2-carboxylic acid);palladium (CID 162370884) is bis(benzo[h]quinoline-2-carboxylic acid);palladium.
What is the SMILES notation for bis(benzo[h]quinoline-2-carboxylic acid);palladium?
The canonical SMILES for bis(benzo[h]quinoline-2-carboxylic acid);palladium is O=C(O)c1ccc2ccc3ccccc3c2n1.O=C(O)c1ccc2ccc3ccccc3c2n1.[Pd].
What is the InChIKey of bis(benzo[h]quinoline-2-carboxylic acid);palladium?
The InChIKey is SVZJROMWRDYCRN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H9NO2.Pd/c2*16-14(17)12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15-12;/h2*1-8H,(H,16,17);.
What are the key properties of bis(benzo[h]quinoline-2-carboxylic acid);palladium?
bis(benzo[h]quinoline-2-carboxylic acid);palladium has a molecular weight of 552.88 g/mol, XLogP of 6.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzo[h]quinoline-2-carboxylic acid);palladium is sourced from PubChem (CID 162370884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).