C14H22ClN3 — CID 162371757
3-N-butan-2-yl-6-chloro-2-N-cyclopentylpyridine-2,3-diamine (PubChem CID 162371757) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 3-N-butan-2-yl-6-chloro-2-N-cyclopentylpyridine-2,3-diamine.
| Compound Name | 3-N-butan-2-yl-6-chloro-2-N-cyclopentylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 162371757 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-N-butan-2-yl-6-chloro-2-N-cyclopentylpyridine-2,3-diamine |
| SMILES | CCC(C)Nc1ccc(Cl)nc1NC1CCCC1 |
| InChI | InChI=1S/C14H22ClN3/c1-3-10(2)16-12-8-9-13(15)18-14(12)17-11-6-4-5-7-11/h8-11,16H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | LHAFXLRLDPLJLQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|