C8H15Cl2NO — CID 162371914
(3S)-1-(1,3-dichloropropan-2-yl)-3-methoxypyrrolidine (PubChem CID 162371914) has the molecular formula C8H15Cl2NO and a molecular weight of 212.12 g/mol. Its IUPAC name is (3S)-1-(1,3-dichloropropan-2-yl)-3-methoxypyrrolidine.
| Compound Name | (3S)-1-(1,3-dichloropropan-2-yl)-3-methoxypyrrolidine |
|---|---|
| PubChem CID | 162371914 |
| Molecular Formula | C8H15Cl2NO |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (3S)-1-(1,3-dichloropropan-2-yl)-3-methoxypyrrolidine |
| SMILES | CO[C@H]1CCN(C(CCl)CCl)C1 |
| InChI | InChI=1S/C8H15Cl2NO/c1-12-8-2-3-11(6-8)7(4-9)5-10/h7-8H,2-6H2,1H3/t8-/m0/s1 |
| InChIKey | IRFOATZILOUATK-QMMMGPOBSA-N |
| XLogP | 1.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|