C25H21N5O5 — CID 162371957
N-[4-[7-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-5-nitrofuran-2-carboxamide (PubChem CID 162371957) has the molecular formula C25H21N5O5 and a molecular weight of 471.47 g/mol. Its IUPAC name is N-[4-[7-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[4-[7-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 162371957 |
| Molecular Formula | C25H21N5O5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[4-[7-(1-acetyl-3,6-dihydro-2H-pyridin-4-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-5-nitrofuran-2-carboxamide |
| SMILES | CC(=O)N1CC=C(c2ccn3c(-c4ccc(NC(=O)c5ccc([N+](=O)[O-])o5)cc4)cnc3c2)CC1 |
| InChI | InChI=1S/C25H21N5O5/c1-16(31)28-11-8-17(9-12-28)19-10-13-29-21(15-26-23(29)14-19)18-2-4-20(5-3-18)27-25(32)22-6-7-24(35-22)30(33)34/h2-8,10,13-15H,9,11-12H2,1H3,(H,27,32) |
| InChIKey | VLRJSYPGGVKGLV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|